CAS 25063-46-1 is the registry number for 5-[(4-Chloro-phenylamino)-methylene]-2,2-dimethyl-[1,3]dioxane-4,6-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
5-[(4-chloroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 25063-46-1) is a chemical compound with the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. IUPAC name: 5-[(4-chloroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: XPVUWQSBIIVTBT-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO4 |
|---|---|
| Molecular weight | 281.69 g/mol |
| IUPAC name | 5-[(4-chloroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | XPVUWQSBIIVTBT-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CNC2=CC=C(C=C2)Cl)C(=O)O1)C |
Computed by PubChem (NCBI)