Products 447418-84-0
CAS 447418-84-0 is the registry number for Ethyl 7-chloro-4-hydroxy-2-methyl-1-oxo-1,2-dihydroisoquinoline-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 7-chloro-4-hydroxy-2-methyl-1-oxoisoquinoline-3-carboxylate (CAS 447418-84-0) is a chemical compound with the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. IUPAC name: ethyl 7-chloro-4-hydroxy-2-methyl-1-oxoisoquinoline-3-carboxylate. InChIKey: LKPVQWIBICYOCD-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO4 |
|---|---|
| Molecular weight | 281.69 g/mol |
| IUPAC name | ethyl 7-chloro-4-hydroxy-2-methyl-1-oxoisoquinoline-3-carboxylate |
| InChIKey | LKPVQWIBICYOCD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(C=C(C=C2)Cl)C(=O)N1C)O |
Computed by PubChem (NCBI)