Products 27333-34-2

CAS 27333-34-2 is the registry number for Ethyl 5-chloro-4-hydroxy-8-methoxyquinoline-3-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 5-chloro-8-methoxy-4-oxo-1H-quinoline-3-carboxylate (CAS 27333-34-2) is a chemical compound with the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. IUPAC name: ethyl 5-chloro-8-methoxy-4-oxo-1H-quinoline-3-carboxylate. InChIKey: NOJJOXUTVCCCKR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12ClNO4
Molecular weight281.69 g/mol
IUPAC nameethyl 5-chloro-8-methoxy-4-oxo-1H-quinoline-3-carboxylate
InChIKeyNOJJOXUTVCCCKR-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CNC2=C(C=CC(=C2C1=O)Cl)OC

Computed by PubChem (NCBI)