CAS 68236-25-9 is the registry number for 2-Chloro-5,6,7-trimethoxy-3-quinolinecarbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 50g, 1g, 25g, 10g, 5g.
2-chloro-5,6,7-trimethoxyquinoline-3-carbaldehyde (CAS 68236-25-9) is a chemical compound with the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. IUPAC name: 2-chloro-5,6,7-trimethoxyquinoline-3-carbaldehyde. InChIKey: BJNANKCDLJBKRZ-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO4 |
|---|---|
| Molecular weight | 281.69 g/mol |
| IUPAC name | 2-chloro-5,6,7-trimethoxyquinoline-3-carbaldehyde |
| InChIKey | BJNANKCDLJBKRZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C=C(C(=NC2=C1)Cl)C=O)OC)OC |
Computed by PubChem (NCBI)