CAS 23756-61-8 is the registry number for 3-Hydroxy-1-indol-3-yl-propane-1,2-dione. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
3-hydroxy-1-(1H-indol-3-yl)propane-1,2-dione (CAS 23756-61-8) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 3-hydroxy-1-(1H-indol-3-yl)propane-1,2-dione. InChIKey: RIRLLZBYBIQRFH-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 3-hydroxy-1-(1H-indol-3-yl)propane-1,2-dione |
| InChIKey | RIRLLZBYBIQRFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)C(=O)CO |
Computed by PubChem (NCBI)