Products 2376501-96-9

CAS 2376501-96-9 is the registry number for 5-HT2CR allosteric modulator 1. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

3-(1-hydroxycyclopentyl)isochromen-1-one (CAS 2376501-96-9) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: 3-(1-hydroxycyclopentyl)isochromen-1-one. InChIKey: PUOGAHNQGDETLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O3
Molecular weight230.26 g/mol
IUPAC name3-(1-hydroxycyclopentyl)isochromen-1-one
InChIKeyPUOGAHNQGDETLJ-UHFFFAOYSA-N
SMILESC1CCC(C1)(C2=CC3=CC=CC=C3C(=O)O2)O

Computed by PubChem (NCBI)

Synonyms: orb3174243