Products 2377275-93-7
CAS 2377275-93-7 is the registry number for (2E)-3-(2,3-Dihydro-5-benzofuranyl)-2-propenenitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enenitrile (CAS 2377275-93-7) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enenitrile. InChIKey: UWTPTWSMPBJSRV-OWOJBTEDSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enenitrile |
| InChIKey | UWTPTWSMPBJSRV-OWOJBTEDSA-N |
| SMILES | C1COC2=C1C=C(C=C2)/C=C/C#N |
Computed by PubChem (NCBI)