Products 2377740-99-1

CAS 2377740-99-1 is the registry number for 3-(TERT-BUTYL) 4-METHYL 2-AMINOTHIOPHENE-3,4-DICARBOXYLATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

3-O-tert-butyl 4-O-methyl 2-aminothiophene-3,4-dicarboxylate (CAS 2377740-99-1) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: 3-O-tert-butyl 4-O-methyl 2-aminothiophene-3,4-dicarboxylate. InChIKey: APURPVNKEXTUKF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO4S
Molecular weight257.31 g/mol
IUPAC name3-O-tert-butyl 4-O-methyl 2-aminothiophene-3,4-dicarboxylate
InChIKeyAPURPVNKEXTUKF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=C(SC=C1C(=O)OC)N

Computed by PubChem (NCBI)