CAS 2378019-98-6 is the registry number for 4-Bromo-3,6-dichloro-2-methylphenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-3,6-dichloro-2-methylphenol (CAS 2378019-98-6) is a chemical compound with the molecular formula C7H5BrCl2O and a molecular weight of 255.92 g/mol. IUPAC name: 4-bromo-3,6-dichloro-2-methylphenol. InChIKey: JVDLUECQABFGNV-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O |
|---|---|
| Molecular weight | 255.92 g/mol |
| IUPAC name | 4-bromo-3,6-dichloro-2-methylphenol |
| InChIKey | JVDLUECQABFGNV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1Cl)Br)Cl)O |
Computed by PubChem (NCBI)