CAS 2378490-12-9 is the registry number for rac-(2R,5S)-5-Cyclohexylpiperidine-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S,5R)-5-cyclohexylpiperidine-2-carboxylic acid;hydrochloride (CAS 2378490-12-9) is a chemical compound with the molecular formula C12H22ClNO2 and a molecular weight of 247.76 g/mol. IUPAC name: (2S,5R)-5-cyclohexylpiperidine-2-carboxylic acid;hydrochloride. InChIKey: DJKSQPFELZPELT-ACMTZBLWSA-N.
| Molecular formula | C12H22ClNO2 |
|---|---|
| Molecular weight | 247.76 g/mol |
| IUPAC name | (2S,5R)-5-cyclohexylpiperidine-2-carboxylic acid;hydrochloride |
| InChIKey | DJKSQPFELZPELT-ACMTZBLWSA-N |
| SMILES | C1CCC(CC1)[C@H]2CC[C@H](NC2)C(=O)O.Cl |
Computed by PubChem (NCBI)