CAS 2378503-41-2 is the registry number for 3-(6-(Dimethylamino)pyridin-3-yl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g, 2g.
3-[6-(dimethylamino)-3-pyridinyl]propanoic acid;hydrochloride (CAS 2378503-41-2) is a chemical compound with the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. IUPAC name: 3-[6-(dimethylamino)-3-pyridinyl]propanoic acid;hydrochloride. InChIKey: CMKSLKNDPFAUQR-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 3-[6-(dimethylamino)-3-pyridinyl]propanoic acid;hydrochloride |
| InChIKey | CMKSLKNDPFAUQR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=C(C=C1)CCC(=O)O.Cl |
Computed by PubChem (NCBI)