Products 2378503-41-2

CAS 2378503-41-2 is the registry number for 3-(6-(Dimethylamino)pyridin-3-yl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g, 2g.

Structural formula: {0} (CAS {1})

3-[6-(dimethylamino)-3-pyridinyl]propanoic acid;hydrochloride (CAS 2378503-41-2) is a chemical compound with the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. IUPAC name: 3-[6-(dimethylamino)-3-pyridinyl]propanoic acid;hydrochloride. InChIKey: CMKSLKNDPFAUQR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15ClN2O2
Molecular weight230.69 g/mol
IUPAC name3-[6-(dimethylamino)-3-pyridinyl]propanoic acid;hydrochloride
InChIKeyCMKSLKNDPFAUQR-UHFFFAOYSA-N
SMILESCN(C)C1=NC=C(C=C1)CCC(=O)O.Cl

Computed by PubChem (NCBI)