Products 2379322-80-0
CAS 2379322-80-0 appears in our catalog under these names: 6-Isopropoxy-2-naphthoic acid, 95%, 6-Isopropoxy-2-naphthoic acid, 98%, 6-Isopropoxy-2-naphthoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
6-propan-2-yloxynaphthalene-2-carboxylic acid (CAS 2379322-80-0) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: 6-propan-2-yloxynaphthalene-2-carboxylic acid. InChIKey: JCLMECLQPNWRBQ-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 6-propan-2-yloxynaphthalene-2-carboxylic acid |
| InChIKey | JCLMECLQPNWRBQ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC2=C(C=C1)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)