Products 2379870-47-8

CAS 2379870-47-8 is the registry number for Lenalidomide-hex-5-ynoic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

6-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]hex-5-ynoic acid (CAS 2379870-47-8) is a chemical compound with the molecular formula C19H18N2O5 and a molecular weight of 354.4 g/mol. IUPAC name: 6-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]hex-5-ynoic acid. InChIKey: JBTWQTFTSVQFNS-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18N2O5
Molecular weight354.4 g/mol
IUPAC name6-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]hex-5-ynoic acid
InChIKeyJBTWQTFTSVQFNS-UHFFFAOYSA-N
SMILESC1CC(=O)NC(=O)C1N2CC3=C(C=CC=C3C2=O)C#CCCCC(=O)O

Computed by PubChem (NCBI)