Products 2380440-11-7
CAS 2380440-11-7 is the registry number for 1-(4-Chlorophenyl)-2-morpholinoethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl (E,4S)-5-(4-bromophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate (CAS 2380440-11-7) is a chemical compound with the molecular formula C17H22BrNO4 and a molecular weight of 384.3 g/mol. IUPAC name: methyl (E,4S)-5-(4-bromophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate. InChIKey: APROCWDFQXLHHA-ATWMFIQVSA-N.
| Molecular formula | C17H22BrNO4 |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | methyl (E,4S)-5-(4-bromophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate |
| InChIKey | APROCWDFQXLHHA-ATWMFIQVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)Br)/C=C/C(=O)OC |
Computed by PubChem (NCBI)