Products 2381078-46-0
CAS 2381078-46-0 is the registry number for Ethyl (1S,2S)-5-bromo-2,3-dihydro-1-hydroxy-1H-indene-2-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl (1S,2S)-5-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate (CAS 2381078-46-0) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: ethyl (1S,2S)-5-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate. InChIKey: ZBXJTDZJKWPAIN-WDEREUQCSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | ethyl (1S,2S)-5-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate |
| InChIKey | ZBXJTDZJKWPAIN-WDEREUQCSA-N |
| SMILES | CCOC(=O)[C@H]1CC2=C([C@H]1O)C=CC(=C2)Br |
Computed by PubChem (NCBI)