CAS 30098-34-1 appears in our catalog under these names: 4-(4-Bromo-2,5-dimethylphenyl)-4-oxobutanoic acid, 95%, 4–(4–Bromo–2,5–dimethylphenyl)–4–oxobutanoic acid, 4-(4-Bromo-2,5-dimethylphenyl)-4-oxobutanoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 1g, 10g.
4-(4-bromo-2,5-dimethylphenyl)-4-oxobutanoic acid (CAS 30098-34-1) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: 4-(4-bromo-2,5-dimethylphenyl)-4-oxobutanoic acid. InChIKey: LLRQYYLOSBQVAO-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | 4-(4-bromo-2,5-dimethylphenyl)-4-oxobutanoic acid |
| InChIKey | LLRQYYLOSBQVAO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)