CAS 1956322-90-9 is the registry number for 8-(Bromomethyl)-2,2,6-trimethyl-4h-benzo[d][1,3]dioxin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
8-(bromomethyl)-2,2,6-trimethyl-1,3-benzodioxin-4-one (CAS 1956322-90-9) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: 8-(bromomethyl)-2,2,6-trimethyl-1,3-benzodioxin-4-one. InChIKey: MEYCVULWQVARCN-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | 8-(bromomethyl)-2,2,6-trimethyl-1,3-benzodioxin-4-one |
| InChIKey | MEYCVULWQVARCN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=O)OC(O2)(C)C)CBr |
Computed by PubChem (NCBI)