CAS 1018948-99-6 appears in our catalog under these names: tert-Butyl 3-bromo-5-formylbenzoate, 95%, tert-Butyl 3-bromo-5-formylbenzoate 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 3-bromo-5-formylbenzoate (CAS 1018948-99-6) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: tert-butyl 3-bromo-5-formylbenzoate. InChIKey: WJYXOHSLYSXYCL-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | tert-butyl 3-bromo-5-formylbenzoate |
| InChIKey | WJYXOHSLYSXYCL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=CC(=C1)C=O)Br |
Computed by PubChem (NCBI)