Products 1152567-60-6
CAS 1152567-60-6 appears in our catalog under these names: 4-(4-Bromophenyl)oxane-4-carboxylic acid, 95%, 4-(4-Bromophenyl)oxane-4-carboxylic acid, 4-(4-Bromophenyl)tetrahydro-2H-pyran-4-carboxylic acid, 97%, 97%, 4-(4-Bromophenyl)oxane-4-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 0,5g, 100mg.
4-(4-bromophenyl)oxane-4-carboxylic acid (CAS 1152567-60-6) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: 4-(4-bromophenyl)oxane-4-carboxylic acid. InChIKey: VTAWBRQRLDUOOG-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | 4-(4-bromophenyl)oxane-4-carboxylic acid |
| InChIKey | VTAWBRQRLDUOOG-UHFFFAOYSA-N |
| SMILES | C1COCCC1(C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)