CAS 1147531-54-1 is the registry number for Benzoic acid, 4-bromo-3-[(2-methyl-2-propen-1-yl)oxy]-, methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-bromo-3-(2-methylprop-2-enoxy)benzoate (CAS 1147531-54-1) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: methyl 4-bromo-3-(2-methylprop-2-enoxy)benzoate. InChIKey: AQRLTIVDZZNPBO-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | methyl 4-bromo-3-(2-methylprop-2-enoxy)benzoate |
| InChIKey | AQRLTIVDZZNPBO-UHFFFAOYSA-N |
| SMILES | CC(=C)COC1=C(C=CC(=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)