Products 2382049-11-6
CAS 2382049-11-6 is the registry number for tert-Butyl (R)-7-(oxazol-4-yl)-1,4-oxazepane-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (7R)-7-(1,3-oxazol-4-yl)-1,4-oxazepane-4-carboxylate (CAS 2382049-11-6) is a chemical compound with the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. IUPAC name: tert-butyl (7R)-7-(1,3-oxazol-4-yl)-1,4-oxazepane-4-carboxylate. InChIKey: ZROLZGILJISSMA-LLVKDONJSA-N.
| Molecular formula | C13H20N2O4 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | tert-butyl (7R)-7-(1,3-oxazol-4-yl)-1,4-oxazepane-4-carboxylate |
| InChIKey | ZROLZGILJISSMA-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](OCC1)C2=COC=N2 |
Computed by PubChem (NCBI)