Products 2383667-92-1
CAS 2383667-92-1 is the registry number for 5-(Methoxycarbonyl)-2,3-dihydro-1-benzofuran-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-methoxycarbonyl-2,3-dihydro-1-benzofuran-3-carboxylic acid (CAS 2383667-92-1) is a chemical compound with the molecular formula C11H10O5 and a molecular weight of 222.19 g/mol. IUPAC name: 5-methoxycarbonyl-2,3-dihydro-1-benzofuran-3-carboxylic acid. InChIKey: CWUAAVBZNNHERV-UHFFFAOYSA-N.
| Molecular formula | C11H10O5 |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | 5-methoxycarbonyl-2,3-dihydro-1-benzofuran-3-carboxylic acid |
| InChIKey | CWUAAVBZNNHERV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)OCC2C(=O)O |
Computed by PubChem (NCBI)