CAS 2383753-64-6 is the registry number for 3-Chloro-6-ethoxy-2-fluorobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-6-ethoxy-2-fluorobenzoic acid (CAS 2383753-64-6) is a chemical compound with the molecular formula C9H8ClFO3 and a molecular weight of 218.61 g/mol. IUPAC name: 3-chloro-6-ethoxy-2-fluorobenzoic acid. InChIKey: MKIXVDPYJAMGNM-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO3 |
|---|---|
| Molecular weight | 218.61 g/mol |
| IUPAC name | 3-chloro-6-ethoxy-2-fluorobenzoic acid |
| InChIKey | MKIXVDPYJAMGNM-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)Cl)F)C(=O)O |
Computed by PubChem (NCBI)