Products 2385106-05-6
CAS 2385106-05-6 is the registry number for 8-Bromoquinoxaline-5-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
8-bromoquinoxaline-5-carboxylic acid (CAS 2385106-05-6) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 8-bromoquinoxaline-5-carboxylic acid. InChIKey: RWYFBOHZNCNNTE-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 8-bromoquinoxaline-5-carboxylic acid |
| InChIKey | RWYFBOHZNCNNTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1C(=O)O)N=CC=N2)Br |
Computed by PubChem (NCBI)