CAS 2385502-17-8 appears in our catalog under these names: 4-Bromo-1,6-dichloro-2,7-naphthyridine, 98%, 4-Bromo-1,6-dichloro-2,7-naphthyridine, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-bromo-1,6-dichloro-2,7-naphthyridine (CAS 2385502-17-8) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 4-bromo-1,6-dichloro-2,7-naphthyridine. InChIKey: WGTUNZACEMJZBT-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 4-bromo-1,6-dichloro-2,7-naphthyridine |
| InChIKey | WGTUNZACEMJZBT-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=C1Cl)C(=NC=C2Br)Cl |
Computed by PubChem (NCBI)