CAS 2385670-61-9 is the registry number for 1-((tert-Butoxycarbonyl)amino)-3-oxocyclopentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxocyclopentane-1-carboxylic acid (CAS 2385670-61-9) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxocyclopentane-1-carboxylic acid. InChIKey: RCVYTTGGYZVJIT-UHFFFAOYSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxocyclopentane-1-carboxylic acid |
| InChIKey | RCVYTTGGYZVJIT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCC(=O)C1)C(=O)O |
Computed by PubChem (NCBI)