CAS 2385723-99-7 is the registry number for 2,4-Dichloro-3-ethoxybenzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4-dichloro-3-ethoxybenzaldehyde (CAS 2385723-99-7) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: 2,4-dichloro-3-ethoxybenzaldehyde. InChIKey: LQDLYVMWKQFUGD-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2,4-dichloro-3-ethoxybenzaldehyde |
| InChIKey | LQDLYVMWKQFUGD-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1Cl)C=O)Cl |
Computed by PubChem (NCBI)