Products 2385992-67-4
CAS 2385992-67-4 is the registry number for 1-Bromo-2-methoxy-5-nitro-4-(trifluoromethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-bromo-2-methoxy-5-nitro-4-(trifluoromethyl)benzene (CAS 2385992-67-4) is a chemical compound with the molecular formula C8H5BrF3NO3 and a molecular weight of 300.03 g/mol. IUPAC name: 1-bromo-2-methoxy-5-nitro-4-(trifluoromethyl)benzene. InChIKey: WQXSFEBUZITPMU-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO3 |
|---|---|
| Molecular weight | 300.03 g/mol |
| IUPAC name | 1-bromo-2-methoxy-5-nitro-4-(trifluoromethyl)benzene |
| InChIKey | WQXSFEBUZITPMU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(F)(F)F)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)