Products 2386661-13-6
CAS 2386661-13-6 appears in our catalog under these names: Labetalol Hydrochloride Impurity 3 (Labetalol Hydrochloride EP Impurity C), 5-(2-(Benzylamino)-1-hydroxyethyl)-2-hydroxybenzamide, Labetalol EP Impurity C. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg, 5mg.
5-[2-(benzylamino)-1-hydroxyethyl]-2-hydroxybenzamide (CAS 2386661-13-6) is a chemical compound with the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. IUPAC name: 5-[2-(benzylamino)-1-hydroxyethyl]-2-hydroxybenzamide. InChIKey: MCYKYHUEIRJDKN-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O3 |
|---|---|
| Molecular weight | 286.33 g/mol |
| IUPAC name | 5-[2-(benzylamino)-1-hydroxyethyl]-2-hydroxybenzamide |
| InChIKey | MCYKYHUEIRJDKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNCC(C2=CC(=C(C=C2)O)C(=O)N)O |
Computed by PubChem (NCBI)