Products 2386816-48-2
CAS 2386816-48-2 is the registry number for 3-Chloro-2,4-dimethylbenzoyl chloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-2,4-dimethylbenzoyl chloride (CAS 2386816-48-2) is a chemical compound with the molecular formula C9H8Cl2O and a molecular weight of 203.06 g/mol. IUPAC name: 3-chloro-2,4-dimethylbenzoyl chloride. InChIKey: VWTIBFWYKGMNQD-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | 3-chloro-2,4-dimethylbenzoyl chloride |
| InChIKey | VWTIBFWYKGMNQD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)Cl)C)Cl |
Computed by PubChem (NCBI)
Synonyms:
3-Chloro-2,4-dimethylbenZoyl chloride