Products 2387561-96-6
CAS 2387561-96-6 is the registry number for (3S)-1-tert-butoxycarbonyl-5,5-dimethyl-piperidine-3-carboxylic acid, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
(3S)-5,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 2387561-96-6) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: (3S)-5,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: UBZXYURSAYNXCX-VIFPVBQESA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | (3S)-5,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | UBZXYURSAYNXCX-VIFPVBQESA-N |
| SMILES | CC1(C[C@@H](CN(C1)C(=O)OC(C)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)