CAS 2387596-74-7 is the registry number for 1-Bromo-3,5-dihydro-4H-pyrrolo[2,3-c]quinolin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one (CAS 2387596-74-7) is a chemical compound with the molecular formula C11H7BrN2O and a molecular weight of 263.09 g/mol. IUPAC name: 1-bromo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one. InChIKey: UKVADEBLCJHZJC-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2O |
|---|---|
| Molecular weight | 263.09 g/mol |
| IUPAC name | 1-bromo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one |
| InChIKey | UKVADEBLCJHZJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C(=O)N2)NC=C3Br |
Computed by PubChem (NCBI)