CAS 2852766-58-4 is the registry number for 4-Bromo-1,3-dihydro-2H-naphtho[2,3-d]imidazol-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-1,3-dihydrobenzo[f]benzimidazol-2-one (CAS 2852766-58-4) is a chemical compound with the molecular formula C11H7BrN2O and a molecular weight of 263.09 g/mol. IUPAC name: 4-bromo-1,3-dihydrobenzo[f]benzimidazol-2-one. InChIKey: RVULEDNDOWCAAC-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2O |
|---|---|
| Molecular weight | 263.09 g/mol |
| IUPAC name | 4-bromo-1,3-dihydrobenzo[f]benzimidazol-2-one |
| InChIKey | RVULEDNDOWCAAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C(=C2Br)NC(=O)N3 |
Computed by PubChem (NCBI)