Products 2767589-65-9
CAS 2767589-65-9 is the registry number for 5-Bromo-2,9a-diazabenzo[cd]azulen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-1,3-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9,11-pentaen-2-one (CAS 2767589-65-9) is a chemical compound with the molecular formula C11H7BrN2O and a molecular weight of 263.09 g/mol. IUPAC name: 7-bromo-1,3-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9,11-pentaen-2-one. InChIKey: JWEGPBJMKLMRMH-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2O |
|---|---|
| Molecular weight | 263.09 g/mol |
| IUPAC name | 7-bromo-1,3-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9,11-pentaen-2-one |
| InChIKey | JWEGPBJMKLMRMH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2N(C=C1)C(=O)N3)Br |
Computed by PubChem (NCBI)