CAS 67643-41-8 appears in our catalog under these names: 6-Bromo-4-hydroxy-8-methylquinoline-3-carbonitrile, 95%, 6-Bromo-4-hydroxy-8-methylquinoline-3-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
6-bromo-8-methyl-4-oxo-1H-quinoline-3-carbonitrile (CAS 67643-41-8) is a chemical compound with the molecular formula C11H7BrN2O and a molecular weight of 263.09 g/mol. IUPAC name: 6-bromo-8-methyl-4-oxo-1H-quinoline-3-carbonitrile. InChIKey: OZUKMNIJUXVVKR-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2O |
|---|---|
| Molecular weight | 263.09 g/mol |
| IUPAC name | 6-bromo-8-methyl-4-oxo-1H-quinoline-3-carbonitrile |
| InChIKey | OZUKMNIJUXVVKR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC=C(C2=O)C#N)Br |
Computed by PubChem (NCBI)