CAS 931325-46-1 is the registry number for 7-bromo-4h,5h-pyrrolo[1,2-a]quinoxalin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-bromo-5H-pyrrolo[1,2-a]quinoxalin-4-one (CAS 931325-46-1) is a chemical compound with the molecular formula C11H7BrN2O and a molecular weight of 263.09 g/mol. IUPAC name: 7-bromo-5H-pyrrolo[1,2-a]quinoxalin-4-one. InChIKey: RNCKOJOKKQPZIB-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2O |
|---|---|
| Molecular weight | 263.09 g/mol |
| IUPAC name | 7-bromo-5H-pyrrolo[1,2-a]quinoxalin-4-one |
| InChIKey | RNCKOJOKKQPZIB-UHFFFAOYSA-N |
| SMILES | C1=CN2C3=C(C=C(C=C3)Br)NC(=O)C2=C1 |
Computed by PubChem (NCBI)