Products 2387602-66-4
CAS 2387602-66-4 is the registry number for 2-Benzhydryl-2,6-diazaspiro[3.4]octan-7-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-benzhydryl-2,7-diazaspiro[3.4]octan-6-one (CAS 2387602-66-4) is a chemical compound with the molecular formula C19H20N2O and a molecular weight of 292.4 g/mol. IUPAC name: 2-benzhydryl-2,7-diazaspiro[3.4]octan-6-one. InChIKey: ZEDMLOWQUKOHFK-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 2-benzhydryl-2,7-diazaspiro[3.4]octan-6-one |
| InChIKey | ZEDMLOWQUKOHFK-UHFFFAOYSA-N |
| SMILES | C1C(=O)NCC12CN(C2)C(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)