CAS 2387732-24-1 is the registry number for 2-Bromo-6,8-dimethoxyindolizine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-6,8-dimethoxyindolizine (CAS 2387732-24-1) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 2-bromo-6,8-dimethoxyindolizine. InChIKey: NHUHJSRATMLVKI-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 2-bromo-6,8-dimethoxyindolizine |
| InChIKey | NHUHJSRATMLVKI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CN2C1=CC(=C2)Br)OC |
Computed by PubChem (NCBI)