Products 2389078-58-2
CAS 2389078-58-2 is the registry number for H-D-Dap(Fmoc)-OtBu*HCl. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g, 500mg.
Tert-butyl (2R)-2-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (CAS 2389078-58-2) is a chemical compound with the molecular formula C22H26N2O4 and a molecular weight of 382.5 g/mol. IUPAC name: tert-butyl (2R)-2-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate. InChIKey: AIVZCRQHFXJCDY-LJQANCHMSA-N.
| Molecular formula | C22H26N2O4 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| InChIKey | AIVZCRQHFXJCDY-LJQANCHMSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)N |
Computed by PubChem (NCBI)