Products 23903-57-3

CAS 23903-57-3 is the registry number for Dihydroorotate Acid Methyl Ester. Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2,6-dioxo-1,3-diazinane-4-carboxylate (CAS 23903-57-3) is a chemical compound with the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. IUPAC name: methyl 2,6-dioxo-1,3-diazinane-4-carboxylate. InChIKey: LRRONAYCHITNSG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8N2O4
Molecular weight172.14 g/mol
IUPAC namemethyl 2,6-dioxo-1,3-diazinane-4-carboxylate
InChIKeyLRRONAYCHITNSG-UHFFFAOYSA-N
SMILESCOC(=O)C1CC(=O)NC(=O)N1

Computed by PubChem (NCBI)