CAS 23975-60-2 is the registry number for 1-(2-Chlorophenyl)-4,4,4-trifluorobutane-1,3-dione, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
1-(2-chlorophenyl)-4,4,4-trifluorobutane-1,3-dione (CAS 23975-60-2) is a chemical compound with the molecular formula C10H6ClF3O2 and a molecular weight of 250.60 g/mol. IUPAC name: 1-(2-chlorophenyl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: LDOOWVILVJMIPB-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF3O2 |
|---|---|
| Molecular weight | 250.60 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | LDOOWVILVJMIPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CC(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)