Products 2407423-32-7
CAS 2407423-32-7 is the registry number for Opabactin. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[[2-(4-cyano-3,5-dicyclopropylphenyl)acetyl]amino]cyclohexane-1-carboxylic acid (CAS 2407423-32-7) is a chemical compound with the molecular formula C22H26N2O3 and a molecular weight of 366.5 g/mol. IUPAC name: 1-[[2-(4-cyano-3,5-dicyclopropylphenyl)acetyl]amino]cyclohexane-1-carboxylic acid. InChIKey: BXNCXSHIFJDMRK-UHFFFAOYSA-N.
| Molecular formula | C22H26N2O3 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | 1-[[2-(4-cyano-3,5-dicyclopropylphenyl)acetyl]amino]cyclohexane-1-carboxylic acid |
| InChIKey | BXNCXSHIFJDMRK-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C(=O)O)NC(=O)CC2=CC(=C(C(=C2)C3CC3)C#N)C4CC4 |
Computed by PubChem (NCBI)