CAS 2407479-90-5 is the registry number for 3-(tert-Butyl) 5-ethyl 2-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3,5-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-O-tert-butyl 5-O-ethyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxylate (CAS 2407479-90-5) is a chemical compound with the molecular formula C16H23NO4S and a molecular weight of 325.4 g/mol. IUPAC name: 3-O-tert-butyl 5-O-ethyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxylate. InChIKey: CAHXUTPPXFAVMW-UHFFFAOYSA-N.
| Molecular formula | C16H23NO4S |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 3-O-tert-butyl 5-O-ethyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxylate |
| InChIKey | CAHXUTPPXFAVMW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC2=C(C1)C(=C(S2)N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)