CAS 61925-78-8 appears in our catalog under these names: Boc-d-cys(mbzl)-oh, 97%, 2-[(tert-Butoxycarbonyl)amino]-3-[(4-methylbenzyl)thio]propanoic acid, 95%, Boc–D–Cys(Mbzl)–OH, Boc-D-Cys(MBzl)-OH, Boc-D-Cys(pMeBzl)-OH, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, Ambeed. Available pack sizes: 1g, 10g, 25g, 5g, 250mg.
(2S)-3-[(4-methylphenyl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 61925-78-8) is a chemical compound with the molecular formula C16H23NO4S and a molecular weight of 325.4 g/mol. IUPAC name: (2S)-3-[(4-methylphenyl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CUNVVZWSABRKAL-CYBMUJFWSA-N.
| Molecular formula | C16H23NO4S |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (2S)-3-[(4-methylphenyl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CUNVVZWSABRKAL-CYBMUJFWSA-N |
| SMILES | CC1=CC=C(C=C1)CSC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)