Products 905706-74-3
CAS 905706-74-3 appears in our catalog under these names: Ethyl 5,5-dimethyl-1-tosylpyrrolidine-2-carboxylate, 98%, 98%, Ethyl 5,5-dimethyl-1-tosylpyrrolidine-2-carboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 5,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate (CAS 905706-74-3) is a chemical compound with the molecular formula C16H23NO4S and a molecular weight of 325.4 g/mol. IUPAC name: ethyl 5,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate. InChIKey: KBTGDSPBENVRLB-UHFFFAOYSA-N.
| Molecular formula | C16H23NO4S |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | ethyl 5,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
| InChIKey | KBTGDSPBENVRLB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC(N1S(=O)(=O)C2=CC=C(C=C2)C)(C)C |
Computed by PubChem (NCBI)