Products 55478-08-5

CAS 55478-08-5 is the registry number for N-Boc-S-benzyl-L-cysteine methyl ester, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl (2R)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 55478-08-5) is a chemical compound with the molecular formula C16H23NO4S and a molecular weight of 325.4 g/mol. IUPAC name: methyl (2R)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: KXUSUGVJXKJTBL-ZDUSSCGKSA-N.

Identity
Molecular formulaC16H23NO4S
Molecular weight325.4 g/mol
IUPAC namemethyl (2R)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
InChIKeyKXUSUGVJXKJTBL-ZDUSSCGKSA-N
SMILESCC(C)(C)OC(=O)N[C@@H](CSCC1=CC=CC=C1)C(=O)OC

Computed by PubChem (NCBI)