Products 1246615-83-7

CAS 1246615-83-7 is the registry number for 2-((4-Nitrophenyl)thio)-acetic Acid Octyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

Octyl 2-(4-nitrophenyl)sulfanylacetate (CAS 1246615-83-7) is a chemical compound with the molecular formula C16H23NO4S and a molecular weight of 325.4 g/mol. IUPAC name: octyl 2-(4-nitrophenyl)sulfanylacetate. InChIKey: JUKHZVNHSBAYCB-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23NO4S
Molecular weight325.4 g/mol
IUPAC nameoctyl 2-(4-nitrophenyl)sulfanylacetate
InChIKeyJUKHZVNHSBAYCB-UHFFFAOYSA-N
SMILESCCCCCCCCOC(=O)CSC1=CC=C(C=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)