CAS 722473-56-5 appears in our catalog under these names: 1-(2,3,5,6-Tetramethyl-benzenesulfonyl)-piperidine-4-carboxylic acid, 95%, 1-(2,3,5,6-Tetramethylbenzenesulfonyl)piperidine-4-carboxylic acid, 95%, 1-(2,3,5,6-Tetramethylbenzenesulfonyl)piperidine-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxylic acid (CAS 722473-56-5) is a chemical compound with the molecular formula C16H23NO4S and a molecular weight of 325.4 g/mol. IUPAC name: 1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxylic acid. InChIKey: JDZUJZPRQPGONL-UHFFFAOYSA-N.
| Molecular formula | C16H23NO4S |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | JDZUJZPRQPGONL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)N2CCC(CC2)C(=O)O)C)C |
Computed by PubChem (NCBI)