CAS 2407559-34-4 is the registry number for (E)-4-Methyl-5-styrylbenzene-1,3-diol. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg, 10 mg.
4-methyl-5-[(E)-2-phenylethenyl]benzene-1,3-diol (CAS 2407559-34-4) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 4-methyl-5-[(E)-2-phenylethenyl]benzene-1,3-diol. InChIKey: MZUWYVKSIRDOKF-BQYQJAHWSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 4-methyl-5-[(E)-2-phenylethenyl]benzene-1,3-diol |
| InChIKey | MZUWYVKSIRDOKF-BQYQJAHWSA-N |
| SMILES | CC1=C(C=C(C=C1O)O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)