CAS 24085-06-1 appears in our catalog under these names: 4–Acetoxy–3–acetoxymethylacetophenone, 1-[4-(Acetyloxy)-3-[(acetyloxy)methyl]phenyl]ethanone. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 500mg.
(5-acetyl-2-acetyloxyphenyl)methyl acetate (CAS 24085-06-1) is a chemical compound with the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. IUPAC name: (5-acetyl-2-acetyloxyphenyl)methyl acetate. InChIKey: FMKMEWWKBLDKST-UHFFFAOYSA-N.
| Molecular formula | C13H14O5 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | (5-acetyl-2-acetyloxyphenyl)methyl acetate |
| InChIKey | FMKMEWWKBLDKST-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OC(=O)C)COC(=O)C |
Computed by PubChem (NCBI)